CAS 1351837-83-6 is the registry number for 1-([1-(3-Chlorophenyl)-1h-1,2,3-triazol-4-yl]carbonyl)piperidin-4-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 5g, 1g.
(4-aminopiperidin-1-yl)-[1-(3-chlorophenyl)triazol-4-yl]methanone (CAS 1351837-83-6) is a chemical compound with the molecular formula C14H16ClN5O and a molecular weight of 305.76 g/mol. IUPAC name: (4-aminopiperidin-1-yl)-[1-(3-chlorophenyl)triazol-4-yl]methanone. InChIKey: NRJLCOBEHRSBAB-UHFFFAOYSA-N.
| Molecular formula | C14H16ClN5O |
|---|---|
| Molecular weight | 305.76 g/mol |
| IUPAC name | (4-aminopiperidin-1-yl)-[1-(3-chlorophenyl)triazol-4-yl]methanone |
| InChIKey | NRJLCOBEHRSBAB-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1N)C(=O)C2=CN(N=N2)C3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)