CAS 1351843-00-9 is the registry number for 1-([1-(3-Fluorophenyl)-1h-1,2,3-triazol-4-yl]carbonyl)piperidin-4-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 100mg.
(4-aminopiperidin-1-yl)-[1-(3-fluorophenyl)triazol-4-yl]methanone (CAS 1351843-00-9) is a chemical compound with the molecular formula C14H16FN5O and a molecular weight of 289.31 g/mol. IUPAC name: (4-aminopiperidin-1-yl)-[1-(3-fluorophenyl)triazol-4-yl]methanone. InChIKey: AMTKHXDCIQIQIF-UHFFFAOYSA-N.
| Molecular formula | C14H16FN5O |
|---|---|
| Molecular weight | 289.31 g/mol |
| IUPAC name | (4-aminopiperidin-1-yl)-[1-(3-fluorophenyl)triazol-4-yl]methanone |
| InChIKey | AMTKHXDCIQIQIF-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1N)C(=O)C2=CN(N=N2)C3=CC(=CC=C3)F |
Computed by PubChem (NCBI)