Products 1351859-46-5

CAS 1351859-46-5 is the registry number for 4-cyano-4-(((phenethylthio)carbonothioyl)thio)pentanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-cyano-4-(2-phenylethylsulfanylcarbothioylsulfanyl)pentanoic acid (CAS 1351859-46-5) is a chemical compound with the molecular formula C15H17NO2S3 and a molecular weight of 339.5 g/mol. IUPAC name: 4-cyano-4-(2-phenylethylsulfanylcarbothioylsulfanyl)pentanoic acid. InChIKey: HIUNIOPNZSEESZ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H17NO2S3
Molecular weight339.5 g/mol
IUPAC name4-cyano-4-(2-phenylethylsulfanylcarbothioylsulfanyl)pentanoic acid
InChIKeyHIUNIOPNZSEESZ-UHFFFAOYSA-N
SMILESCC(CCC(=O)O)(C#N)SC(=S)SCCC1=CC=CC=C1

Computed by PubChem (NCBI)