CAS 13519-91-0 is the registry number for 2-fluorobenzene-1,3,5-tricarbonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-fluorobenzene-1,3,5-tricarbonitrile (CAS 13519-91-0) is a chemical compound with the molecular formula C9H2FN3 and a molecular weight of 171.13 g/mol. IUPAC name: 2-fluorobenzene-1,3,5-tricarbonitrile. InChIKey: QDJOGIDHYNTWNM-UHFFFAOYSA-N.
| Molecular formula | C9H2FN3 |
|---|---|
| Molecular weight | 171.13 g/mol |
| IUPAC name | 2-fluorobenzene-1,3,5-tricarbonitrile |
| InChIKey | QDJOGIDHYNTWNM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C#N)F)C#N)C#N |
Computed by PubChem (NCBI)