CAS 135192-53-9 appears in our catalog under these names: Pentafluorophenyl chlorothionoformate, 95%, Pentafluorophenyl Chlorothionoformate, Pentafluorophenyl Chlorothionoformate, Pentafluorophenyl Chlorothionoformate, >95.0%(GC). Offered by: Combi-blocks, TRC, GLPBio, Biosynth, TCI. Available pack sizes: 5g, 1g, 100mg, 500mg, 50mg, 0,25g, 0,5g, 2g.
O-(2,3,4,5,6-pentafluorophenyl) chloromethanethioate (CAS 135192-53-9) is a chemical compound with the molecular formula C7ClF5OS and a molecular weight of 262.58 g/mol. IUPAC name: O-(2,3,4,5,6-pentafluorophenyl) chloromethanethioate. InChIKey: DKFQHZNKNWNZCO-UHFFFAOYSA-N.
| Molecular formula | C7ClF5OS |
|---|---|
| Molecular weight | 262.58 g/mol |
| IUPAC name | O-(2,3,4,5,6-pentafluorophenyl) chloromethanethioate |
| InChIKey | DKFQHZNKNWNZCO-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)F)OC(=S)Cl |
Computed by PubChem (NCBI)