CAS 1351990-53-8 is the registry number for 2-(Piperazin-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-piperazin-1-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine (CAS 1351990-53-8) is a chemical compound with the molecular formula C14H23BN4O2 and a molecular weight of 290.17 g/mol. IUPAC name: 2-piperazin-1-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine. InChIKey: PHUVWCNWYRCFFR-UHFFFAOYSA-N.
| Molecular formula | C14H23BN4O2 |
|---|---|
| Molecular weight | 290.17 g/mol |
| IUPAC name | 2-piperazin-1-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine |
| InChIKey | PHUVWCNWYRCFFR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)N3CCNCC3 |
Computed by PubChem (NCBI)