CAS 135206-93-8 appears in our catalog under these names: 2-(Chloromethyl)-1-(2,2,2-trifluoroethyl)-1H-imidazole hydrochloride, 95%, 2-(Chloromethyl)-1-(2,2,2-trifluoroethyl)-1H-imidazole hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-(chloromethyl)-1-(2,2,2-trifluoroethyl)imidazole;hydrochloride (CAS 135206-93-8) is a chemical compound with the molecular formula C6H7Cl2F3N2 and a molecular weight of 235.03 g/mol. IUPAC name: 2-(chloromethyl)-1-(2,2,2-trifluoroethyl)imidazole;hydrochloride. InChIKey: UKSYSNBTTVWGSV-UHFFFAOYSA-N.
| Molecular formula | C6H7Cl2F3N2 |
|---|---|
| Molecular weight | 235.03 g/mol |
| IUPAC name | 2-(chloromethyl)-1-(2,2,2-trifluoroethyl)imidazole;hydrochloride |
| InChIKey | UKSYSNBTTVWGSV-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=N1)CCl)CC(F)(F)F.Cl |
Computed by PubChem (NCBI)