CAS 13521-83-0 appears in our catalog under these names: Glutaric acid disodium salt, 98%, Sodium glutarate, 98%, Disodium Glutarate, Disodium Glutarate, >99.0%(T), Sodium glutarate, 99%+,RG, 99%+,RG. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 25g, 100g, 500g, 1g, 5g.
Disodium;pentanedioate (CAS 13521-83-0) is a chemical compound with the molecular formula C5H6Na2O4 and a molecular weight of 176.08 g/mol. IUPAC name: disodium;pentanedioate. InChIKey: ZUDYLZOBWIAUPC-UHFFFAOYSA-L.
| Molecular formula | C5H6Na2O4 |
|---|---|
| Molecular weight | 176.08 g/mol |
| IUPAC name | disodium;pentanedioate |
| InChIKey | ZUDYLZOBWIAUPC-UHFFFAOYSA-L |
| SMILES | C(CC(=O)[O-])CC(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)