Products 1352185-26-2

CAS 1352185-26-2 appears in our catalog under these names: Schineolignin B, ≥98%, ≥98%, Schineolignin B, 98.25%. Offered by: Chemat, MedChemExpress. Available pack sizes: 20mg, 5 mg, 1 mg.

Structural formula: {0} (CAS {1})

5-[4-(3,4-dimethoxyphenyl)-2,3-dimethylbutyl]-2,3-dimethoxyphenol (CAS 1352185-26-2) is a chemical compound with the molecular formula C22H30O5 and a molecular weight of 374.5 g/mol. IUPAC name: 5-[4-(3,4-dimethoxyphenyl)-2,3-dimethylbutyl]-2,3-dimethoxyphenol. InChIKey: ITXTZJSELNILSN-UHFFFAOYSA-N.

Identity
Molecular formulaC22H30O5
Molecular weight374.5 g/mol
IUPAC name5-[4-(3,4-dimethoxyphenyl)-2,3-dimethylbutyl]-2,3-dimethoxyphenol
InChIKeyITXTZJSELNILSN-UHFFFAOYSA-N
SMILESCC(CC1=CC(=C(C=C1)OC)OC)C(C)CC2=CC(=C(C(=C2)OC)OC)O

Computed by PubChem (NCBI)