CAS 1352231-84-5 is the registry number for 2-chloro-1-(3-chloro-4-methylphenyl)-2,2-difluoroethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 50mg.
2-chloro-1-(3-chloro-4-methylphenyl)-2,2-difluoroethanone (CAS 1352231-84-5) is a chemical compound with the molecular formula C9H6Cl2F2O and a molecular weight of 239.04 g/mol. IUPAC name: 2-chloro-1-(3-chloro-4-methylphenyl)-2,2-difluoroethanone. InChIKey: VJYRZXMBSZYHLX-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2F2O |
|---|---|
| Molecular weight | 239.04 g/mol |
| IUPAC name | 2-chloro-1-(3-chloro-4-methylphenyl)-2,2-difluoroethanone |
| InChIKey | VJYRZXMBSZYHLX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)C(F)(F)Cl)Cl |
Computed by PubChem (NCBI)