CAS 1352232-04-2 is the registry number for 2-chloro-1-(3,4-dichlorophenyl)-2,2-difluoroethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-chloro-1-(3,4-dichlorophenyl)-2,2-difluoroethanone (CAS 1352232-04-2) is a chemical compound with the molecular formula C8H3Cl3F2O and a molecular weight of 259.5 g/mol. IUPAC name: 2-chloro-1-(3,4-dichlorophenyl)-2,2-difluoroethanone. InChIKey: XAIFBHOWSNQUMY-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl3F2O |
|---|---|
| Molecular weight | 259.5 g/mol |
| IUPAC name | 2-chloro-1-(3,4-dichlorophenyl)-2,2-difluoroethanone |
| InChIKey | XAIFBHOWSNQUMY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)C(F)(F)Cl)Cl)Cl |
Computed by PubChem (NCBI)