CAS 1352305-17-9 is the registry number for 1-(2-Chlorophenyl)-n1,n1-dimethylethane-1,2-diamine dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg, 25g.
1-(2-chlorophenyl)-N,N-dimethylethane-1,2-diamine;dihydrochloride (CAS 1352305-17-9) is a chemical compound with the molecular formula C10H17Cl3N2 and a molecular weight of 271.6 g/mol. IUPAC name: 1-(2-chlorophenyl)-N,N-dimethylethane-1,2-diamine;dihydrochloride. InChIKey: NKMBDPGSWXSJRB-UHFFFAOYSA-N.
| Molecular formula | C10H17Cl3N2 |
|---|---|
| Molecular weight | 271.6 g/mol |
| IUPAC name | 1-(2-chlorophenyl)-N,N-dimethylethane-1,2-diamine;dihydrochloride |
| InChIKey | NKMBDPGSWXSJRB-UHFFFAOYSA-N |
| SMILES | CN(C)C(CN)C1=CC=CC=C1Cl.Cl.Cl |
Computed by PubChem (NCBI)