CAS 1352440-75-5 is the registry number for N-(4-Chloro-3-(trifluoromethyl)phenyl)-2-hydroxy-5-nitrobenzamide. Offered by: TRC. Available pack sizes: 5g.
N-[4-chloro-3-(trifluoromethyl)phenyl]-2-hydroxy-5-nitrobenzamide (CAS 1352440-75-5) is a chemical compound with the molecular formula C14H8ClF3N2O4 and a molecular weight of 360.67 g/mol. IUPAC name: N-[4-chloro-3-(trifluoromethyl)phenyl]-2-hydroxy-5-nitrobenzamide. InChIKey: OWWRTEUTTPOCHR-UHFFFAOYSA-N.
| Molecular formula | C14H8ClF3N2O4 |
|---|---|
| Molecular weight | 360.67 g/mol |
| IUPAC name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-hydroxy-5-nitrobenzamide |
| InChIKey | OWWRTEUTTPOCHR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC(=O)C2=C(C=CC(=C2)[N+](=O)[O-])O)C(F)(F)F)Cl |
Computed by PubChem (NCBI)