Products 1352477-22-5
CAS 1352477-22-5 is the registry number for q-FTAA. Offered by: MedChemExpress. Available pack sizes: 100 mg, 5 mg, 10 mg, 50 mg, 25 mg.
5-[4-(carboxymethyl)-5-[5-[3-(carboxymethyl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophene-2-carboxylic acid (CAS 1352477-22-5) is a chemical compound with the molecular formula C21H14O6S4 and a molecular weight of 490.6 g/mol. IUPAC name: 5-[4-(carboxymethyl)-5-[5-[3-(carboxymethyl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophene-2-carboxylic acid. InChIKey: RAIQRQPSJZWULW-UHFFFAOYSA-N.
| Molecular formula | C21H14O6S4 |
|---|---|
| Molecular weight | 490.6 g/mol |
| IUPAC name | 5-[4-(carboxymethyl)-5-[5-[3-(carboxymethyl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophene-2-carboxylic acid |
| InChIKey | RAIQRQPSJZWULW-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1CC(=O)O)C2=CC=C(S2)C3=C(C=C(S3)C4=CC=C(S4)C(=O)O)CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
q-FTAA, orb1744122