CAS 1352571-83-5 is the registry number for (1R)-5-Fluoro-2,3-dihydro-1H-inden-1-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1R)-5-fluoro-2,3-dihydro-1H-inden-1-amine (CAS 1352571-83-5) is a chemical compound with the molecular formula C9H10FN and a molecular weight of 151.18 g/mol. IUPAC name: (1R)-5-fluoro-2,3-dihydro-1H-inden-1-amine. InChIKey: POTIEZMRLKEJOZ-SECBINFHSA-N.
| Molecular formula | C9H10FN |
|---|---|
| Molecular weight | 151.18 g/mol |
| IUPAC name | (1R)-5-fluoro-2,3-dihydro-1H-inden-1-amine |
| InChIKey | POTIEZMRLKEJOZ-SECBINFHSA-N |
| SMILES | C1CC2=C([C@@H]1N)C=CC(=C2)F |
Computed by PubChem (NCBI)