Products 1352709-56-8
CAS 1352709-56-8 is the registry number for (2S)-4-tert-butoxycarbonyl-2-methyl-morpholine-2-carboxylic acid, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(2S)-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-2-carboxylic acid (CAS 1352709-56-8) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: (2S)-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-2-carboxylic acid. InChIKey: SQAMEQQMXRHVTC-NSHDSACASA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | (2S)-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-2-carboxylic acid |
| InChIKey | SQAMEQQMXRHVTC-NSHDSACASA-N |
| SMILES | C[C@]1(CN(CCO1)C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)