CAS 1352723-61-5 is the registry number for Methyl 5-methyl-3-(2,2,2-trifluoroacetamido)thiophene-2-carboxylate, 90%. Offered by: Combi-blocks. Available pack sizes: 500mg.
Methyl 5-methyl-3-[(2,2,2-trifluoroacetyl)amino]thiophene-2-carboxylate (CAS 1352723-61-5) is a chemical compound with the molecular formula C9H8F3NO3S and a molecular weight of 267.23 g/mol. IUPAC name: methyl 5-methyl-3-[(2,2,2-trifluoroacetyl)amino]thiophene-2-carboxylate. InChIKey: SRRIHCUXXGXYKI-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO3S |
|---|---|
| Molecular weight | 267.23 g/mol |
| IUPAC name | methyl 5-methyl-3-[(2,2,2-trifluoroacetyl)amino]thiophene-2-carboxylate |
| InChIKey | SRRIHCUXXGXYKI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(S1)C(=O)OC)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)