CAS 1352796-66-7 is the registry number for N,N-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-6-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-6-amine (CAS 1352796-66-7) is a chemical compound with the molecular formula C16H23BN2O2 and a molecular weight of 286.2 g/mol. IUPAC name: N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-6-amine. InChIKey: SNQTVCNBYUKQFB-UHFFFAOYSA-N.
| Molecular formula | C16H23BN2O2 |
|---|---|
| Molecular weight | 286.2 g/mol |
| IUPAC name | N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-6-amine |
| InChIKey | SNQTVCNBYUKQFB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC3=C2C=CN3)N(C)C |
Computed by PubChem (NCBI)