CAS 13528-88-6 is the registry number for 1,1,2-Trichloro-1,2,2-trimethyldisilane. Offered by: Chemat Brand. Available pack sizes: on request.
Dichloro-[chloro(dimethyl)silyl]-methylsilane (CAS 13528-88-6) is a chemical compound with the molecular formula C3H9Cl3Si2 and a molecular weight of 207.63 g/mol. IUPAC name: dichloro-[chloro(dimethyl)silyl]-methylsilane. InChIKey: KTPJDYNQZVAFBU-UHFFFAOYSA-N.
| Molecular formula | C3H9Cl3Si2 |
|---|---|
| Molecular weight | 207.63 g/mol |
| IUPAC name | dichloro-[chloro(dimethyl)silyl]-methylsilane |
| InChIKey | KTPJDYNQZVAFBU-UHFFFAOYSA-N |
| SMILES | C[Si](C)([Si](C)(Cl)Cl)Cl |
Computed by PubChem (NCBI)