CAS 1353011-83-2 is the registry number for Ethyl 5-bromo-1-(2,4-dichlorophenyl)-4-formyl-1h-pyrazole-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg.
Ethyl 5-bromo-1-(2,4-dichlorophenyl)-4-formylpyrazole-3-carboxylate (CAS 1353011-83-2) is a chemical compound with the molecular formula C13H9BrCl2N2O3 and a molecular weight of 392.0 g/mol. IUPAC name: ethyl 5-bromo-1-(2,4-dichlorophenyl)-4-formylpyrazole-3-carboxylate. InChIKey: NVKMODBEOXYFHN-UHFFFAOYSA-N.
| Molecular formula | C13H9BrCl2N2O3 |
|---|---|
| Molecular weight | 392.0 g/mol |
| IUPAC name | ethyl 5-bromo-1-(2,4-dichlorophenyl)-4-formylpyrazole-3-carboxylate |
| InChIKey | NVKMODBEOXYFHN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN(C(=C1C=O)Br)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)