CAS 1353016-71-3 appears in our catalog under these names: DBCO-NHS Ester, DBCO-NHS ester/ 98.02% (existing batch purity), DBCO–NHS ester, Dbco- nhs ester, DBCO-NHS Ester, >98.0%(HPLC)(T). Offered by: TRC, TargetMol, GLPBio, Biosynth, TCI. Available pack sizes: 100mg, 1mg, 50mg, 5mg, 10mg, 25mg, 10mM (in 1ml dmso), 0,1g.
(2,5-dioxopyrrolidin-1-yl) 4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoate (CAS 1353016-71-3) is a chemical compound with the molecular formula C23H18N2O5 and a molecular weight of 402.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoate. InChIKey: XCEBOJWFQSQZKR-UHFFFAOYSA-N.
| Molecular formula | C23H18N2O5 |
|---|---|
| Molecular weight | 402.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoate |
| InChIKey | XCEBOJWFQSQZKR-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCC(=O)N2CC3=CC=CC=C3C#CC4=CC=CC=C42 |
Computed by PubChem (NCBI)