CAS 135304-08-4 appears in our catalog under these names: Ac-cys(farnesyl)-ome, 95%, Ac-Cys(farnesyl)-OMe, L-ACFM, Ac–Cys(farnesyl)–OMe. Offered by: Combi-blocks, Creative Peptides, TRC, GLPBio, Biosynth. Available pack sizes: 500mg, 100mg, 1g.
Methyl (2R)-2-acetamido-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoate (CAS 135304-08-4) is a chemical compound with the molecular formula C21H35NO3S and a molecular weight of 381.6 g/mol. IUPAC name: methyl (2R)-2-acetamido-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoate. InChIKey: MXSBUVKSWFWHTQ-WOWWHVILSA-N.
| Molecular formula | C21H35NO3S |
|---|---|
| Molecular weight | 381.6 g/mol |
| IUPAC name | methyl (2R)-2-acetamido-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoate |
| InChIKey | MXSBUVKSWFWHTQ-WOWWHVILSA-N |
| SMILES | CC(=CCC/C(=C/CC/C(=C/CSC[C@@H](C(=O)OC)NC(=O)C)/C)/C)C |
Computed by PubChem (NCBI)