CAS 1353085-67-2 appears in our catalog under these names: (S)-tert-Butyl morpholine-3-carboxylate, 98%, (S)-3-Morpholinecarboxylic Acid 1,1-Dimethylethyl Ester. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 5g.
Tert-butyl (3S)-morpholine-3-carboxylate (CAS 1353085-67-2) is a chemical compound with the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. IUPAC name: tert-butyl (3S)-morpholine-3-carboxylate. InChIKey: QTJBNPAWSNUZIC-ZETCQYMHSA-N.
| Molecular formula | C9H17NO3 |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | tert-butyl (3S)-morpholine-3-carboxylate |
| InChIKey | QTJBNPAWSNUZIC-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]1COCCN1 |
Computed by PubChem (NCBI)