CAS 1353087-61-2 appears in our catalog under these names: 2,6-Dichloro-5-iodonicotinonitrile, 95%, 2,6–Dichloro–5–iodonicotinonitrile. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
2,6-dichloro-5-iodopyridine-3-carbonitrile (CAS 1353087-61-2) is a chemical compound with the molecular formula C6HCl2IN2 and a molecular weight of 298.89 g/mol. IUPAC name: 2,6-dichloro-5-iodopyridine-3-carbonitrile. InChIKey: XYWZESOQBNMGLL-UHFFFAOYSA-N.
| Molecular formula | C6HCl2IN2 |
|---|---|
| Molecular weight | 298.89 g/mol |
| IUPAC name | 2,6-dichloro-5-iodopyridine-3-carbonitrile |
| InChIKey | XYWZESOQBNMGLL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=C1I)Cl)Cl)C#N |
Computed by PubChem (NCBI)