Products 135309-02-3
CAS 135309-02-3 is the registry number for 8,8''-Bibaicalein. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, 5 mg, 1 mg.
5,6,7-trihydroxy-2-phenyl-8-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)chromen-4-one (CAS 135309-02-3) is a chemical compound with the molecular formula C30H18O10 and a molecular weight of 538.5 g/mol. IUPAC name: 5,6,7-trihydroxy-2-phenyl-8-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)chromen-4-one. InChIKey: NRYPLIKKTVVLMK-UHFFFAOYSA-N.
| Molecular formula | C30H18O10 |
|---|---|
| Molecular weight | 538.5 g/mol |
| IUPAC name | 5,6,7-trihydroxy-2-phenyl-8-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)chromen-4-one |
| InChIKey | NRYPLIKKTVVLMK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)C3=C(C(=C(C(=C3O2)C4=C5C(=C(C(=C4O)O)O)C(=O)C=C(O5)C6=CC=CC=C6)O)O)O |
Computed by PubChem (NCBI)