CAS 13531-35-6 is the registry number for rac cis-2-Phenylcyclopropylamine. Offered by: TRC. Available pack sizes: 250mg.
Cis-(1R,2R)-2-phenylcyclopropan-1-amine (CAS 13531-35-6) is a chemical compound with the molecular formula C9H11N and a molecular weight of 133.19 g/mol. IUPAC name: cis-(1R,2R)-2-phenylcyclopropan-1-amine. InChIKey: AELCINSCMGFISI-RKDXNWHRSA-N.
| Molecular formula | C9H11N |
|---|---|
| Molecular weight | 133.19 g/mol |
| IUPAC name | cis-(1R,2R)-2-phenylcyclopropan-1-amine |
| InChIKey | AELCINSCMGFISI-RKDXNWHRSA-N |
| SMILES | C1[C@@H]([C@@H]1N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)