CAS 13532-96-2 appears in our catalog under these names: 4-Diazo-N-ethyl-N-(2-hydroxyethyl)aniline Chloride Zinc Chloride, >94.0%(T), 4-[ethyl(2-hydroxyethyl)amino]benzenediazonium chloride zinc chloride, ≥94%(T), ≥94%(T). Offered by: TCI, Chemat. Available pack sizes: 25g, 1g, 5g.
Dichlorozinc;4-[ethyl(2-hydroxyethyl)amino]benzenediazonium;chloride (CAS 13532-96-2) is a chemical compound with the molecular formula C10H14Cl3N3OZn and a molecular weight of 364.0 g/mol. IUPAC name: dichlorozinc;4-[ethyl(2-hydroxyethyl)amino]benzenediazonium;chloride. InChIKey: FOZURDCUSZRTCY-UHFFFAOYSA-K.
| Molecular formula | C10H14Cl3N3OZn |
|---|---|
| Molecular weight | 364.0 g/mol |
| IUPAC name | dichlorozinc;4-[ethyl(2-hydroxyethyl)amino]benzenediazonium;chloride |
| InChIKey | FOZURDCUSZRTCY-UHFFFAOYSA-K |
| SMILES | CCN(CCO)C1=CC=C(C=C1)[N+]#N.[Cl-].Cl[Zn]Cl |
Computed by PubChem (NCBI)