Products 135330-85-7
CAS 135330-85-7 is the registry number for AFK-108. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[2-(2,4-dichlorophenyl)-2-[(2E)-3,7-dimethylocta-2,6-dienoxy]ethyl]imidazole (CAS 135330-85-7) is a chemical compound with the molecular formula C21H26Cl2N2O and a molecular weight of 393.3 g/mol. IUPAC name: 1-[2-(2,4-dichlorophenyl)-2-[(2E)-3,7-dimethylocta-2,6-dienoxy]ethyl]imidazole. InChIKey: KUJPUHSUDJSBKU-RQZCQDPDSA-N.
| Molecular formula | C21H26Cl2N2O |
|---|---|
| Molecular weight | 393.3 g/mol |
| IUPAC name | 1-[2-(2,4-dichlorophenyl)-2-[(2E)-3,7-dimethylocta-2,6-dienoxy]ethyl]imidazole |
| InChIKey | KUJPUHSUDJSBKU-RQZCQDPDSA-N |
| SMILES | CC(=CCC/C(=C/COC(CN1C=CN=C1)C2=C(C=C(C=C2)Cl)Cl)/C)C |
Computed by PubChem (NCBI)