CAS 1353349-61-7 is the registry number for 3-(N-(tert-Butoxycarbonyl)sulfamoyl)-5-(butylamino)-4-phenoxybenzoic Acid. Offered by: TRC. Available pack sizes: 250mg.
3-(butylamino)-5-[(2-methylpropan-2-yl)oxycarbonylsulfamoyl]-4-phenoxybenzoic acid (CAS 1353349-61-7) is a chemical compound with the molecular formula C22H28N2O7S and a molecular weight of 464.5 g/mol. IUPAC name: 3-(butylamino)-5-[(2-methylpropan-2-yl)oxycarbonylsulfamoyl]-4-phenoxybenzoic acid. InChIKey: IWJBJEUPKMZXQO-UHFFFAOYSA-N.
| Molecular formula | C22H28N2O7S |
|---|---|
| Molecular weight | 464.5 g/mol |
| IUPAC name | 3-(butylamino)-5-[(2-methylpropan-2-yl)oxycarbonylsulfamoyl]-4-phenoxybenzoic acid |
| InChIKey | IWJBJEUPKMZXQO-UHFFFAOYSA-N |
| SMILES | CCCCNC1=C(C(=CC(=C1)C(=O)O)S(=O)(=O)NC(=O)OC(C)(C)C)OC2=CC=CC=C2 |
Computed by PubChem (NCBI)