CAS 1353496-62-4 is the registry number for 6-(Aminomethyl)-3-methyl-1,2-dihydroquinolin-2-one hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-(aminomethyl)-3-methyl-1H-quinolin-2-one;hydrochloride (CAS 1353496-62-4) is a chemical compound with the molecular formula C11H13ClN2O and a molecular weight of 224.68 g/mol. IUPAC name: 6-(aminomethyl)-3-methyl-1H-quinolin-2-one;hydrochloride. InChIKey: MWXGBVRRLLFUMF-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O |
|---|---|
| Molecular weight | 224.68 g/mol |
| IUPAC name | 6-(aminomethyl)-3-methyl-1H-quinolin-2-one;hydrochloride |
| InChIKey | MWXGBVRRLLFUMF-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=CC(=C2)CN)NC1=O.Cl |
Computed by PubChem (NCBI)