CAS 1353497-89-8 is the registry number for 5,7-Dichloro-4-iodo-2,3-dihydrobenzofuran, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,7-dichloro-4-iodo-2,3-dihydro-1-benzofuran (CAS 1353497-89-8) is a chemical compound with the molecular formula C8H5Cl2IO and a molecular weight of 314.93 g/mol. IUPAC name: 5,7-dichloro-4-iodo-2,3-dihydro-1-benzofuran. InChIKey: LXHPFWHWMMNEAI-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2IO |
|---|---|
| Molecular weight | 314.93 g/mol |
| IUPAC name | 5,7-dichloro-4-iodo-2,3-dihydro-1-benzofuran |
| InChIKey | LXHPFWHWMMNEAI-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C(=C(C=C2Cl)Cl)I |
Computed by PubChem (NCBI)