CAS 135357-96-9 is the registry number for Restricticin. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(2S,3R,4S,5S)-2-[(2E,4E,6E)-deca-2,4,6-trien-2-yl]-4-methoxy-5-methyloxan-3-yl] 2-aminoacetate (CAS 135357-96-9) is a chemical compound with the molecular formula C19H31NO4 and a molecular weight of 337.5 g/mol. IUPAC name: [(2S,3R,4S,5S)-2-[(2E,4E,6E)-deca-2,4,6-trien-2-yl]-4-methoxy-5-methyloxan-3-yl] 2-aminoacetate. InChIKey: FIFAQBUMNRZWOQ-WGFJUHIKSA-N.
| Molecular formula | C19H31NO4 |
|---|---|
| Molecular weight | 337.5 g/mol |
| IUPAC name | [(2S,3R,4S,5S)-2-[(2E,4E,6E)-deca-2,4,6-trien-2-yl]-4-methoxy-5-methyloxan-3-yl] 2-aminoacetate |
| InChIKey | FIFAQBUMNRZWOQ-WGFJUHIKSA-N |
| SMILES | CCC/C=C/C=C/C=C(\C)/[C@H]1[C@@H]([C@H]([C@H](CO1)C)OC)OC(=O)CN |
Computed by PubChem (NCBI)