CAS 1353578-66-1 is the registry number for 2-Fluoro-4-hydroxy-3',5'-difluoro-4'-(trifluoromethyl)biphenyl, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-[3,5-difluoro-4-(trifluoromethyl)phenyl]-3-fluorophenol (CAS 1353578-66-1) is a chemical compound with the molecular formula C13H6F6O and a molecular weight of 292.18 g/mol. IUPAC name: 4-[3,5-difluoro-4-(trifluoromethyl)phenyl]-3-fluorophenol. InChIKey: OQQDHIWDUFCSTF-UHFFFAOYSA-N.
| Molecular formula | C13H6F6O |
|---|---|
| Molecular weight | 292.18 g/mol |
| IUPAC name | 4-[3,5-difluoro-4-(trifluoromethyl)phenyl]-3-fluorophenol |
| InChIKey | OQQDHIWDUFCSTF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)F)C2=CC(=C(C(=C2)F)C(F)(F)F)F |
Computed by PubChem (NCBI)