CAS 1353583-27-3 is the registry number for 5-Formyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nicotinamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-formyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxamide (CAS 1353583-27-3) is a chemical compound with the molecular formula C13H17BN2O4 and a molecular weight of 276.10 g/mol. IUPAC name: 5-formyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxamide. InChIKey: DUSIKXVEELTKOM-UHFFFAOYSA-N.
| Molecular formula | C13H17BN2O4 |
|---|---|
| Molecular weight | 276.10 g/mol |
| IUPAC name | 5-formyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxamide |
| InChIKey | DUSIKXVEELTKOM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=NC=C2C=O)C(=O)N |
Computed by PubChem (NCBI)