CAS 1353753-57-7 is the registry number for Pretomanid Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
(6S)-2-nitro-6-[[3-(trifluoromethoxy)phenyl]methoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine (CAS 1353753-57-7) is a chemical compound with the molecular formula C14H12F3N3O5 and a molecular weight of 359.26 g/mol. IUPAC name: (6S)-2-nitro-6-[[3-(trifluoromethoxy)phenyl]methoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine. InChIKey: OOPIHEXKZKNPRB-NSHDSACASA-N.
| Molecular formula | C14H12F3N3O5 |
|---|---|
| Molecular weight | 359.26 g/mol |
| IUPAC name | (6S)-2-nitro-6-[[3-(trifluoromethoxy)phenyl]methoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
| InChIKey | OOPIHEXKZKNPRB-NSHDSACASA-N |
| SMILES | C1[C@@H](COC2=NC(=CN21)[N+](=O)[O-])OCC3=CC(=CC=C3)OC(F)(F)F |
Computed by PubChem (NCBI)