CAS 1353844-77-5 appears in our catalog under these names: Valsartan Impurity 32, N,N-bis((2'-Cyano(1,1'-biphenyl)-4-yl)methyl)-methyl Ester L-Valine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
Methyl (2S)-2-[bis[[4-(2-cyanophenyl)phenyl]methyl]amino]-3-methylbutanoate (CAS 1353844-77-5) is a chemical compound with the molecular formula C34H31N3O2 and a molecular weight of 513.6 g/mol. IUPAC name: methyl (2S)-2-[bis[[4-(2-cyanophenyl)phenyl]methyl]amino]-3-methylbutanoate. InChIKey: ACHVMIPEFRAHGY-XIFFEERXSA-N.
| Molecular formula | C34H31N3O2 |
|---|---|
| Molecular weight | 513.6 g/mol |
| IUPAC name | methyl (2S)-2-[bis[[4-(2-cyanophenyl)phenyl]methyl]amino]-3-methylbutanoate |
| InChIKey | ACHVMIPEFRAHGY-XIFFEERXSA-N |
| SMILES | CC(C)[C@@H](C(=O)OC)N(CC1=CC=C(C=C1)C2=CC=CC=C2C#N)CC3=CC=C(C=C3)C4=CC=CC=C4C#N |
Computed by PubChem (NCBI)