CAS 1353867-74-9 appears in our catalog under these names: Oxyclozanide-13C6, 13C6-Oxyclozanide, Concentration: 100 µg/ml Solvent: Acetonitrile, 13C6-Oxyclozanide. Offered by: Chemat Brand, HPC Standards. Available pack sizes: on request, 1x1ml, 1x10mg.
2,3,5-trichloro-N-(3,5-dichloro-2-hydroxyphenyl)-6-hydroxybenzamide (CAS 1353867-74-9) is a chemical compound with the molecular formula C13H6Cl5NO3 and a molecular weight of 401.4 g/mol. IUPAC name: 2,3,5-trichloro-N-(3,5-dichloro-2-hydroxyphenyl)-6-hydroxybenzamide. InChIKey: JYWIYHUXVMAGLG-UHFFFAOYSA-N.
| Molecular formula | C13H6Cl5NO3 |
|---|---|
| Molecular weight | 401.4 g/mol |
| IUPAC name | 2,3,5-trichloro-N-(3,5-dichloro-2-hydroxyphenyl)-6-hydroxybenzamide |
| InChIKey | JYWIYHUXVMAGLG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1NC(=O)C2=C(C(=CC(=C2Cl)Cl)Cl)O)O)Cl)Cl |
Computed by PubChem (NCBI)