CAS 1353945-22-8 appears in our catalog under these names: (6-Chloro-2-methanesulfinyl-pyrimidin-4-yl)-methyl-amine, 95%, 4-Pyrimidinamine, 6-chloro-N-methyl-2-(methylsulfinyl)-, 95%, 6–chloro–N–methyl–2–(methylsulfinyl)pyrimidin–4–amine, (6-Chloro-2-methanesulfinyl-pyrimidin-4-yl)-methyl-amine. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
6-chloro-N-methyl-2-methylsulfinylpyrimidin-4-amine (CAS 1353945-22-8) is a chemical compound with the molecular formula C6H8ClN3OS and a molecular weight of 205.67 g/mol. IUPAC name: 6-chloro-N-methyl-2-methylsulfinylpyrimidin-4-amine. InChIKey: YZPNVDZULLTKDA-UHFFFAOYSA-N.
| Molecular formula | C6H8ClN3OS |
|---|---|
| Molecular weight | 205.67 g/mol |
| IUPAC name | 6-chloro-N-methyl-2-methylsulfinylpyrimidin-4-amine |
| InChIKey | YZPNVDZULLTKDA-UHFFFAOYSA-N |
| SMILES | CNC1=CC(=NC(=N1)S(=O)C)Cl |
Computed by PubChem (NCBI)