CAS 1353958-55-0 appears in our catalog under these names: tert-Butyl 3-(((2,4-dichlorophenyl)thio)methyl)piperidine-1-carboxylate, 95%, 95%, 3-(2,4-Dichloro-phenylsulfanylmethyl)-piperidine-1-carboxylic acid tert-butyl ester, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
Tert-butyl 3-[(2,4-dichlorophenyl)sulfanylmethyl]piperidine-1-carboxylate (CAS 1353958-55-0) is a chemical compound with the molecular formula C17H23Cl2NO2S and a molecular weight of 376.3 g/mol. IUPAC name: tert-butyl 3-[(2,4-dichlorophenyl)sulfanylmethyl]piperidine-1-carboxylate. InChIKey: LHMASSSAOGSSHM-UHFFFAOYSA-N.
| Molecular formula | C17H23Cl2NO2S |
|---|---|
| Molecular weight | 376.3 g/mol |
| IUPAC name | tert-butyl 3-[(2,4-dichlorophenyl)sulfanylmethyl]piperidine-1-carboxylate |
| InChIKey | LHMASSSAOGSSHM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C1)CSC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)