Products 1353973-88-2
CAS 1353973-88-2 is the registry number for tert-Butyl 4-(2-chloronicotinamido)piperidine-1-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Tert-butyl 4-[(2-chloropyridine-3-carbonyl)amino]piperidine-1-carboxylate (CAS 1353973-88-2) is a chemical compound with the molecular formula C16H22ClN3O3 and a molecular weight of 339.82 g/mol. IUPAC name: tert-butyl 4-[(2-chloropyridine-3-carbonyl)amino]piperidine-1-carboxylate. InChIKey: ZYRGPALZDUAREE-UHFFFAOYSA-N.
| Molecular formula | C16H22ClN3O3 |
|---|---|
| Molecular weight | 339.82 g/mol |
| IUPAC name | tert-butyl 4-[(2-chloropyridine-3-carbonyl)amino]piperidine-1-carboxylate |
| InChIKey | ZYRGPALZDUAREE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)NC(=O)C2=C(N=CC=C2)Cl |
Computed by PubChem (NCBI)