CAS 1353986-11-4 appears in our catalog under these names: 1-((2,4-Dichlorophenyl)sulfonyl)-2-methylpiperazine hydrochloride, 95%, 95%, 1-(2,4-Dichloro-benzenesulfonyl)-2-methyl-piperazine hydrochloride, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-(2,4-dichlorophenyl)sulfonyl-2-methylpiperazine;hydrochloride (CAS 1353986-11-4) is a chemical compound with the molecular formula C11H15Cl3N2O2S and a molecular weight of 345.7 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)sulfonyl-2-methylpiperazine;hydrochloride. InChIKey: VJOGQYMDMYQSNF-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl3N2O2S |
|---|---|
| Molecular weight | 345.7 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)sulfonyl-2-methylpiperazine;hydrochloride |
| InChIKey | VJOGQYMDMYQSNF-UHFFFAOYSA-N |
| SMILES | CC1CNCCN1S(=O)(=O)C2=C(C=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)