CAS 1354010-01-7 appears in our catalog under these names: (S)-tert-Butyl 3-(3-methylthiophene-2-carboxamido)pyrrolidine-1-carboxylate, 95%, 95%, (S)-3-[(3-Methyl-thiophene-2-carbonyl)-amino]-pyrrolidine-1-carboxylic acid tert-butyl ester, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
Tert-butyl (3S)-3-[(3-methylthiophene-2-carbonyl)amino]pyrrolidine-1-carboxylate (CAS 1354010-01-7) is a chemical compound with the molecular formula C15H22N2O3S and a molecular weight of 310.4 g/mol. IUPAC name: tert-butyl (3S)-3-[(3-methylthiophene-2-carbonyl)amino]pyrrolidine-1-carboxylate. InChIKey: WZHFWDNNSKXSLY-NSHDSACASA-N.
| Molecular formula | C15H22N2O3S |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | tert-butyl (3S)-3-[(3-methylthiophene-2-carbonyl)amino]pyrrolidine-1-carboxylate |
| InChIKey | WZHFWDNNSKXSLY-NSHDSACASA-N |
| SMILES | CC1=C(SC=C1)C(=O)N[C@H]2CCN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)