Products 1354018-51-1
CAS 1354018-51-1 is the registry number for 3-Methyl-thiophene-2-carboxylic acid (S)-pyrrolidin-3-ylamide hydrochloride, 95%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg.
3-methyl-N-[(3S)-pyrrolidin-3-yl]thiophene-2-carboxamide;hydrochloride (CAS 1354018-51-1) is a chemical compound with the molecular formula C10H15ClN2OS and a molecular weight of 246.76 g/mol. IUPAC name: 3-methyl-N-[(3S)-pyrrolidin-3-yl]thiophene-2-carboxamide;hydrochloride. InChIKey: RIQYQDRXQXBQKD-QRPNPIFTSA-N.
| Molecular formula | C10H15ClN2OS |
|---|---|
| Molecular weight | 246.76 g/mol |
| IUPAC name | 3-methyl-N-[(3S)-pyrrolidin-3-yl]thiophene-2-carboxamide;hydrochloride |
| InChIKey | RIQYQDRXQXBQKD-QRPNPIFTSA-N |
| SMILES | CC1=C(SC=C1)C(=O)N[C@H]2CCNC2.Cl |
Computed by PubChem (NCBI)