Products 1354020-91-9
CAS 1354020-91-9 appears in our catalog under these names: (R)-tert-Butyl 3-((6-ethoxypyrimidin-4-yl)amino)pyrrolidine-1-carboxylate, 95%, 95%, (R)-3-(6-Ethoxy-pyrimidin-4-ylamino)-pyrrolidine-1-carboxylic acid tert-butyl ester, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
Tert-butyl (3R)-3-[(6-ethoxypyrimidin-4-yl)amino]pyrrolidine-1-carboxylate (CAS 1354020-91-9) is a chemical compound with the molecular formula C15H24N4O3 and a molecular weight of 308.38 g/mol. IUPAC name: tert-butyl (3R)-3-[(6-ethoxypyrimidin-4-yl)amino]pyrrolidine-1-carboxylate. InChIKey: WLTVDSYFDQNMGF-LLVKDONJSA-N.
| Molecular formula | C15H24N4O3 |
|---|---|
| Molecular weight | 308.38 g/mol |
| IUPAC name | tert-butyl (3R)-3-[(6-ethoxypyrimidin-4-yl)amino]pyrrolidine-1-carboxylate |
| InChIKey | WLTVDSYFDQNMGF-LLVKDONJSA-N |
| SMILES | CCOC1=NC=NC(=C1)N[C@@H]2CCN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)