CAS 1354029-57-4 is the registry number for tert-Butyl ((1-((S)-2-aminopropanoyl)pyrrolidin-2-yl)methyl)(isopropyl)carbamate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[[1-[(2S)-2-aminopropanoyl]pyrrolidin-2-yl]methyl]-N-propan-2-ylcarbamate (CAS 1354029-57-4) is a chemical compound with the molecular formula C16H31N3O3 and a molecular weight of 313.44 g/mol. IUPAC name: tert-butyl N-[[1-[(2S)-2-aminopropanoyl]pyrrolidin-2-yl]methyl]-N-propan-2-ylcarbamate. InChIKey: ONBYQGMALZAXEY-UEWDXFNNSA-N.
| Molecular formula | C16H31N3O3 |
|---|---|
| Molecular weight | 313.44 g/mol |
| IUPAC name | tert-butyl N-[[1-[(2S)-2-aminopropanoyl]pyrrolidin-2-yl]methyl]-N-propan-2-ylcarbamate |
| InChIKey | ONBYQGMALZAXEY-UEWDXFNNSA-N |
| SMILES | C[C@@H](C(=O)N1CCCC1CN(C(C)C)C(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)