CAS 1354030-51-5 appears in our catalog under these names: UNC9994, 5-(3-(4-(2,3-Dichlorophenyl)-1-piperidinyl)propoxy)benzothiazole, UNC9994, 98.06%. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 10 mg, 25 mg, 5 mg.
5-[3-[4-(2,3-dichlorophenyl)piperidin-1-yl]propoxy]-1,3-benzothiazole;hydrochloride (CAS 1354030-51-5) is a chemical compound with the molecular formula C21H23Cl3N2OS and a molecular weight of 457.8 g/mol. IUPAC name: 5-[3-[4-(2,3-dichlorophenyl)piperidin-1-yl]propoxy]-1,3-benzothiazole;hydrochloride. InChIKey: MTDQOQYYKZUEEK-UHFFFAOYSA-N.
| Molecular formula | C21H23Cl3N2OS |
|---|---|
| Molecular weight | 457.8 g/mol |
| IUPAC name | 5-[3-[4-(2,3-dichlorophenyl)piperidin-1-yl]propoxy]-1,3-benzothiazole;hydrochloride |
| InChIKey | MTDQOQYYKZUEEK-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C2=C(C(=CC=C2)Cl)Cl)CCCOC3=CC4=C(C=C3)SC=N4.Cl |
Computed by PubChem (NCBI)