Products 1354351-30-6

CAS 1354351-30-6 is the registry number for tert-Butyl (4-fluoropiperidin-4-yl)methylcarbamate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(4-fluoropiperidin-4-yl)methyl]carbamate;hydrochloride (CAS 1354351-30-6) is a chemical compound with the molecular formula C11H22ClFN2O2 and a molecular weight of 268.75 g/mol. IUPAC name: tert-butyl N-[(4-fluoropiperidin-4-yl)methyl]carbamate;hydrochloride. InChIKey: BJZKYSGISHYROW-UHFFFAOYSA-N.

Identity
Molecular formulaC11H22ClFN2O2
Molecular weight268.75 g/mol
IUPAC nametert-butyl N-[(4-fluoropiperidin-4-yl)methyl]carbamate;hydrochloride
InChIKeyBJZKYSGISHYROW-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCC1(CCNCC1)F.Cl

Computed by PubChem (NCBI)