CAS 1354360-11-4 is the registry number for rel-(1R,5S)-Bicyclo(3.2.0)heptane-3-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
(1R,5S)-bicyclo[3.2.0]heptane-3-carboxylic acid (CAS 1354360-11-4) is a chemical compound with the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. IUPAC name: (1R,5S)-bicyclo[3.2.0]heptane-3-carboxylic acid. InChIKey: BSRWDKBOIQWNBC-MEKDEQNOSA-N.
| Molecular formula | C8H12O2 |
|---|---|
| Molecular weight | 140.18 g/mol |
| IUPAC name | (1R,5S)-bicyclo[3.2.0]heptane-3-carboxylic acid |
| InChIKey | BSRWDKBOIQWNBC-MEKDEQNOSA-N |
| SMILES | C1C[C@@H]2[C@H]1CC(C2)C(=O)O |
Computed by PubChem (NCBI)