CAS 1354381-74-0 is the registry number for rel-(1S,4S,5S)-5-Fluoro-2-azabicyclo[2.2.1]heptane, 97+%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,4S,5S)-5-fluoro-2-azabicyclo[2.2.1]heptane (CAS 1354381-74-0) is a chemical compound with the molecular formula C6H10FN and a molecular weight of 115.15 g/mol. IUPAC name: (1S,4S,5S)-5-fluoro-2-azabicyclo[2.2.1]heptane. InChIKey: OAJNJXJCKQKODM-ZLUOBGJFSA-N.
| Molecular formula | C6H10FN |
|---|---|
| Molecular weight | 115.15 g/mol |
| IUPAC name | (1S,4S,5S)-5-fluoro-2-azabicyclo[2.2.1]heptane |
| InChIKey | OAJNJXJCKQKODM-ZLUOBGJFSA-N |
| SMILES | C1[C@H]2C[C@@H]([C@@H]1CN2)F |
Computed by PubChem (NCBI)