CAS 135441-88-2 is the registry number for rac Geosmin-d3. Offered by: TRC. Available pack sizes: 500mg.
(4S,4aS,8aR)-4-methyl-8a-(trideuteriomethyl)-1,2,3,4,5,6,7,8-octahydronaphthalen-4a-ol (CAS 135441-88-2) is a chemical compound with the molecular formula C12H22O and a molecular weight of 185.32 g/mol. IUPAC name: (4S,4aS,8aR)-4-methyl-8a-(trideuteriomethyl)-1,2,3,4,5,6,7,8-octahydronaphthalen-4a-ol. InChIKey: JLPUXFOGCDVKGO-VQNRWZNNSA-N.
| Molecular formula | C12H22O |
|---|---|
| Molecular weight | 185.32 g/mol |
| IUPAC name | (4S,4aS,8aR)-4-methyl-8a-(trideuteriomethyl)-1,2,3,4,5,6,7,8-octahydronaphthalen-4a-ol |
| InChIKey | JLPUXFOGCDVKGO-VQNRWZNNSA-N |
| SMILES | [2H]C([2H])([2H])[C@]12CCCC[C@@]1([C@H](CCC2)C)O |
Computed by PubChem (NCBI)